C19H31NO2 — CID 88670250
2,6-ditert-butyl-4-(morpholin-2-ylmethyl)phenol (PubChem CID 88670250) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(morpholin-2-ylmethyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(morpholin-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 88670250 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2,6-ditert-butyl-4-(morpholin-2-ylmethyl)phenol |
| SMILES | CC(C)(C)c1cc(CC2CNCCO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H31NO2/c1-18(2,3)15-10-13(9-14-12-20-7-8-22-14)11-16(17(15)21)19(4,5)6/h10-11,14,20-21H,7-9,12H2,1-6H3 |
| InChIKey | UDJYBMILKMTMQN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |