About 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol
2-benzylmorpholine;2-(trifluoromethyl)benzenethiol (PubChem CID 142864888) has the molecular formula C18H20F3NOS
and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol.
Molecular Properties
| Compound Name | 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol |
| PubChem CID | 142864888 |
| Molecular Formula | C18H20F3NOS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol |
| SMILES | FC(F)(F)c1ccccc1S.c1ccc(CC2CNCCO2)cc1 |
| InChI | InChI=1S/C11H15NO.C7H5F3S/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11;8-7(9,10)5-3-1-2-4-6(5)11/h1-5,11-12H,6-9H2;1-4,11H |
| InChIKey | KYCPHCBPBQDBPV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol?
The IUPAC name of 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol (CID 142864888) is 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol.
What is the SMILES notation for 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol?
The canonical SMILES for 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol is FC(F)(F)c1ccccc1S.c1ccc(CC2CNCCO2)cc1.
What is the InChIKey of 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol?
The InChIKey is KYCPHCBPBQDBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C7H5F3S/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11;8-7(9,10)5-3-1-2-4-6(5)11/h1-5,11-12H,6-9H2;1-4,11H.
What are the key properties of 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol?
2-benzylmorpholine;2-(trifluoromethyl)benzenethiol has a molecular weight of 355.43 g/mol, XLogP of 4.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylmorpholine;2-(trifluoromethyl)benzenethiol is sourced from PubChem (CID 142864888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).