About 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine
2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine (PubChem CID 142864910) has the molecular formula C19H25NO2S
and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine.
Molecular Properties
| Compound Name | 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine |
| PubChem CID | 142864910 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine |
| SMILES | COc1ccccc1S.Cc1ccc(CC2CNCCO2)cc1 |
| InChI | InChI=1S/C12H17NO.C7H8OS/c1-10-2-4-11(5-3-10)8-12-9-13-6-7-14-12;1-8-6-4-2-3-5-7(6)9/h2-5,12-13H,6-9H2,1H3;2-5,9H,1H3 |
| InChIKey | UZPFSIQYAZSOFL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine?
The IUPAC name of 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine (CID 142864910) is 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine.
What is the SMILES notation for 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine?
The canonical SMILES for 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine is COc1ccccc1S.Cc1ccc(CC2CNCCO2)cc1.
What is the InChIKey of 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine?
The InChIKey is UZPFSIQYAZSOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C7H8OS/c1-10-2-4-11(5-3-10)8-12-9-13-6-7-14-12;1-8-6-4-2-3-5-7(6)9/h2-5,12-13H,6-9H2,1H3;2-5,9H,1H3.
What are the key properties of 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine?
2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine has a molecular weight of 331.48 g/mol, XLogP of 3.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzenethiol;2-[(4-methylphenyl)methyl]morpholine is sourced from PubChem (CID 142864910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).