C34H50O5 — CID 139646322
2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-hydroxyphenyl)-(oxiran-2-yl)methoxy]-(oxiran-2-yl)methyl]phenol (PubChem CID 139646322) has the molecular formula C34H50O5 and a molecular weight of 538.77 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-hydroxyphenyl)-(oxiran-2-yl)methoxy]-(oxiran-2-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-hydroxyphenyl)-(oxiran-2-yl)methoxy]-(oxiran-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 139646322 |
| Molecular Formula | C34H50O5 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | 2,6-ditert-butyl-4-[[(3,5-ditert-butyl-4-hydroxyphenyl)-(oxiran-2-yl)methoxy]-(oxiran-2-yl)methyl]phenol |
| SMILES | CC(C)(C)c1cc(C(OC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C2CO2)C2CO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H50O5/c1-31(2,3)21-13-19(14-22(27(21)35)32(4,5)6)29(25-17-37-25)39-30(26-18-38-26)20-15-23(33(7,8)9)28(36)24(16-20)34(10,11)12/h13-16,25-26,29-30,35-36H,17-18H2,1-12H3 |
| InChIKey | WMZQSQIUMNVBSP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|