C20H33NO — CID 171197827
4-[(R)-amino(cyclopentyl)methyl]-2,6-ditert-butylphenol (PubChem CID 171197827) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 4-[(R)-amino(cyclopentyl)methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(R)-amino(cyclopentyl)methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 171197827 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 4-[(R)-amino(cyclopentyl)methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc([C@H](N)C2CCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H33NO/c1-19(2,3)15-11-14(17(21)13-9-7-8-10-13)12-16(18(15)22)20(4,5)6/h11-13,17,22H,7-10,21H2,1-6H3/t17-/m1/s1 |
| InChIKey | AJYPESCQALNLSI-QGZVFWFLSA-N |
| XLogP | 5.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |