C13H20ClNO — CID 171224638
4-[(S)-amino(cyclobutyl)methyl]-2,6-dimethylphenol;hydrochloride (PubChem CID 171224638) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 4-[(S)-amino(cyclobutyl)methyl]-2,6-dimethylphenol;hydrochloride.
| Compound Name | 4-[(S)-amino(cyclobutyl)methyl]-2,6-dimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 171224638 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[(S)-amino(cyclobutyl)methyl]-2,6-dimethylphenol;hydrochloride |
| SMILES | Cc1cc([C@@H](N)C2CCC2)cc(C)c1O.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-8-6-11(7-9(2)13(8)15)12(14)10-4-3-5-10;/h6-7,10,12,15H,3-5,14H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | ZVNZRVNGVWHPMC-YDALLXLXSA-N |
| XLogP | 3.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |