C21H36ClNO — CID 171217339
4-[(S)-amino(cyclohexyl)methyl]-2,6-ditert-butylphenol;hydrochloride (PubChem CID 171217339) has the molecular formula C21H36ClNO and a molecular weight of 353.98 g/mol. Its IUPAC name is 4-[(S)-amino(cyclohexyl)methyl]-2,6-ditert-butylphenol;hydrochloride.
| Compound Name | 4-[(S)-amino(cyclohexyl)methyl]-2,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 171217339 |
| Molecular Formula | C21H36ClNO |
| Molecular Weight | 353.98 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-[(S)-amino(cyclohexyl)methyl]-2,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc([C@@H](N)C2CCCCC2)cc(C(C)(C)C)c1O.Cl |
| InChI | InChI=1S/C21H35NO.ClH/c1-20(2,3)16-12-15(13-17(19(16)23)21(4,5)6)18(22)14-10-8-7-9-11-14;/h12-14,18,23H,7-11,22H2,1-6H3;1H/t18-;/m0./s1 |
| InChIKey | BXGPLDBHPKGTAD-FERBBOLQSA-N |
| XLogP | 5.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.98 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |