C27H38O — CID 132820450
2,6-ditert-butyl-4-[cyclohexyl(phenyl)methyl]phenol (PubChem CID 132820450) has the molecular formula C27H38O and a molecular weight of 378.60 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[cyclohexyl(phenyl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[cyclohexyl(phenyl)methyl]phenol |
|---|---|
| PubChem CID | 132820450 |
| Molecular Formula | C27H38O |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 2,6-ditert-butyl-4-[cyclohexyl(phenyl)methyl]phenol |
| SMILES | CC(C)(C)c1cc(C(c2ccccc2)C2CCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H38O/c1-26(2,3)22-17-21(18-23(25(22)28)27(4,5)6)24(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7,9-10,13-14,17-18,20,24,28H,8,11-12,15-16H2,1-6H3 |
| InChIKey | GKZWWTSAVRALLF-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |