C25H35NO — CID 88613087
2,6-ditert-butyl-4-[1-(2,3-dihydro-1H-inden-2-ylamino)ethyl]phenol (PubChem CID 88613087) has the molecular formula C25H35NO and a molecular weight of 365.56 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1-(2,3-dihydro-1H-inden-2-ylamino)ethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1-(2,3-dihydro-1H-inden-2-ylamino)ethyl]phenol |
|---|---|
| PubChem CID | 88613087 |
| Molecular Formula | C25H35NO |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[1-(2,3-dihydro-1H-inden-2-ylamino)ethyl]phenol |
| SMILES | CC(NC1Cc2ccccc2C1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H35NO/c1-16(26-20-12-17-10-8-9-11-18(17)13-20)19-14-21(24(2,3)4)23(27)22(15-19)25(5,6)7/h8-11,14-16,20,26-27H,12-13H2,1-7H3 |
| InChIKey | PMADLWXZELXJEG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |