C27H38O2 — CID 132820452
2,6-ditert-butyl-4-[cyclopentyl-(4-methoxyphenyl)methyl]phenol (PubChem CID 132820452) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[cyclopentyl-(4-methoxyphenyl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[cyclopentyl-(4-methoxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 132820452 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 2,6-ditert-butyl-4-[cyclopentyl-(4-methoxyphenyl)methyl]phenol |
| SMILES | COc1ccc(C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C2CCCC2)cc1 |
| InChI | InChI=1S/C27H38O2/c1-26(2,3)22-16-20(17-23(25(22)28)27(4,5)6)24(18-10-8-9-11-18)19-12-14-21(29-7)15-13-19/h12-18,24,28H,8-11H2,1-7H3 |
| InChIKey | HSHMVBKHJWURGH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |