C25H34O2 — CID 132573747
2,6-ditert-butyl-4-[1-(4-methoxyphenyl)but-3-enyl]phenol (PubChem CID 132573747) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1-(4-methoxyphenyl)but-3-enyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1-(4-methoxyphenyl)but-3-enyl]phenol |
|---|---|
| PubChem CID | 132573747 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2,6-ditert-butyl-4-[1-(4-methoxyphenyl)but-3-enyl]phenol |
| SMILES | C=CCC(c1ccc(OC)cc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34O2/c1-9-10-20(17-11-13-19(27-8)14-12-17)18-15-21(24(2,3)4)23(26)22(16-18)25(5,6)7/h9,11-16,20,26H,1,10H2,2-8H3 |
| InChIKey | RPOOZNPMPAITFH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|