C37H53NO3 — CID 15312102
2,6-ditert-butyl-4-[[N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methoxyanilino]methyl]phenol (PubChem CID 15312102) has the molecular formula C37H53NO3 and a molecular weight of 559.84 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methoxyanilino]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methoxyanilino]methyl]phenol |
|---|---|
| PubChem CID | 15312102 |
| Molecular Formula | C37H53NO3 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.40 |
| IUPAC Name | 2,6-ditert-butyl-4-[[N-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methoxyanilino]methyl]phenol |
| SMILES | COc1ccc(N(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C37H53NO3/c1-34(2,3)28-18-24(19-29(32(28)39)35(4,5)6)22-38(26-14-16-27(41-13)17-15-26)23-25-20-30(36(7,8)9)33(40)31(21-25)37(10,11)12/h14-21,39-40H,22-23H2,1-13H3 |
| InChIKey | LMDXYLHAMINXJA-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|