C22H37NO2 — CID 130317136
4-[5-(1-aminopropyl)oxan-2-yl]-2,6-ditert-butylphenol (PubChem CID 130317136) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 4-[5-(1-aminopropyl)oxan-2-yl]-2,6-ditert-butylphenol.
| Compound Name | 4-[5-(1-aminopropyl)oxan-2-yl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 130317136 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 4-[5-(1-aminopropyl)oxan-2-yl]-2,6-ditert-butylphenol |
| SMILES | CCC(N)C1CCC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC1 |
| InChI | InChI=1S/C22H37NO2/c1-8-18(23)14-9-10-19(25-13-14)15-11-16(21(2,3)4)20(24)17(12-15)22(5,6)7/h11-12,14,18-19,24H,8-10,13,23H2,1-7H3 |
| InChIKey | OEFOGMGDURPJEI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |