C32H50O — CID 144959528
4-(4-butan-2-yl-2,6-ditert-butylphenyl)-2,6-ditert-butylphenol (PubChem CID 144959528) has the molecular formula C32H50O and a molecular weight of 450.75 g/mol. Its IUPAC name is 4-(4-butan-2-yl-2,6-ditert-butylphenyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(4-butan-2-yl-2,6-ditert-butylphenyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 144959528 |
| Molecular Formula | C32H50O |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | 4-(4-butan-2-yl-2,6-ditert-butylphenyl)-2,6-ditert-butylphenol |
| SMILES | CCC(C)c1cc(C(C)(C)C)c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H50O/c1-15-20(2)21-16-23(29(3,4)5)27(24(17-21)30(6,7)8)22-18-25(31(9,10)11)28(33)26(19-22)32(12,13)14/h16-20,33H,15H2,1-14H3 |
| InChIKey | SERQBJCKPXRXNO-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |