C25H43NO — CID 142231486
2,6-ditert-butyl-4-[3-[(4-methylcyclohexyl)methylamino]propyl]phenol (PubChem CID 142231486) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-[(4-methylcyclohexyl)methylamino]propyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[3-[(4-methylcyclohexyl)methylamino]propyl]phenol |
|---|---|
| PubChem CID | 142231486 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-[(4-methylcyclohexyl)methylamino]propyl]phenol |
| SMILES | CC1CCC(CNCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C25H43NO/c1-18-10-12-19(13-11-18)17-26-14-8-9-20-15-21(24(2,3)4)23(27)22(16-20)25(5,6)7/h15-16,18-19,26-27H,8-14,17H2,1-7H3 |
| InChIKey | WSEUAFJMOHONJW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|