C40H62O2 — CID 19003383
2-tert-butyl-4-[8-(3-tert-butyl-5-cyclohexyl-4-hydroxyphenyl)octyl]-6-cyclohexylphenol (PubChem CID 19003383) has the molecular formula C40H62O2 and a molecular weight of 574.93 g/mol. Its IUPAC name is 2-tert-butyl-4-[8-(3-tert-butyl-5-cyclohexyl-4-hydroxyphenyl)octyl]-6-cyclohexylphenol.
| Compound Name | 2-tert-butyl-4-[8-(3-tert-butyl-5-cyclohexyl-4-hydroxyphenyl)octyl]-6-cyclohexylphenol |
|---|---|
| PubChem CID | 19003383 |
| Molecular Formula | C40H62O2 |
| Molecular Weight | 574.93 g/mol |
| Exact Mass | 574.47 |
| IUPAC Name | 2-tert-butyl-4-[8-(3-tert-butyl-5-cyclohexyl-4-hydroxyphenyl)octyl]-6-cyclohexylphenol |
| SMILES | CC(C)(C)c1cc(CCCCCCCCc2cc(C3CCCCC3)c(O)c(C(C)(C)C)c2)cc(C2CCCCC2)c1O |
| InChI | InChI=1S/C40H62O2/c1-39(2,3)35-27-29(25-33(37(35)41)31-21-15-11-16-22-31)19-13-9-7-8-10-14-20-30-26-34(32-23-17-12-18-24-32)38(42)36(28-30)40(4,5)6/h25-28,31-32,41-42H,7-24H2,1-6H3 |
| InChIKey | WMABOQNSZWFVTI-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.93 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|