C31H57O5P — CID 140986607
(3,5-ditert-butyl-4-hydroxyphenyl)methyl dioctyl phosphate (PubChem CID 140986607) has the molecular formula C31H57O5P and a molecular weight of 540.77 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl dioctyl phosphate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl dioctyl phosphate |
|---|---|
| PubChem CID | 140986607 |
| Molecular Formula | C31H57O5P |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl dioctyl phosphate |
| SMILES | CCCCCCCCOP(=O)(OCCCCCCCC)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H57O5P/c1-9-11-13-15-17-19-21-34-37(33,35-22-20-18-16-14-12-10-2)36-25-26-23-27(30(3,4)5)29(32)28(24-26)31(6,7)8/h23-24,32H,9-22,25H2,1-8H3 |
| InChIKey | DRUIHKFYSGEPTA-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|