C47H52N2O3 — CID 54010835
bis[1-[3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]naphthalen-2-yl]methanone (PubChem CID 54010835) has the molecular formula C47H52N2O3 and a molecular weight of 692.94 g/mol. Its IUPAC name is bis[1-[3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]naphthalen-2-yl]methanone.
| Compound Name | bis[1-[3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 54010835 |
| Molecular Formula | C47H52N2O3 |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.40 |
| IUPAC Name | bis[1-[3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]naphthalen-2-yl]methanone |
| SMILES | CN(C)Cc1cc(-c2c(C(=O)c3ccc4ccccc4c3-c3cc(CN(C)C)c(O)c(C(C)(C)C)c3)ccc3ccccc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C47H52N2O3/c1-46(2,3)39-25-31(23-33(43(39)50)27-48(7)8)41-35-17-13-11-15-29(35)19-21-37(41)45(52)38-22-20-30-16-12-14-18-36(30)42(38)32-24-34(28-49(9)10)44(51)40(26-32)47(4,5)6/h11-26,50-51H,27-28H2,1-10H3 |
| InChIKey | KSFMQYBIAXSPQT-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|