C30H30N2O2 — CID 170895271
6-(3,5-ditert-butyl-4-hydroxyphenyl)benzo[a]phenazin-5-ol (PubChem CID 170895271) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is 6-(3,5-ditert-butyl-4-hydroxyphenyl)benzo[a]phenazin-5-ol.
| Compound Name | 6-(3,5-ditert-butyl-4-hydroxyphenyl)benzo[a]phenazin-5-ol |
|---|---|
| PubChem CID | 170895271 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 6-(3,5-ditert-butyl-4-hydroxyphenyl)benzo[a]phenazin-5-ol |
| SMILES | CC(C)(C)c1cc(-c2c(O)c3ccccc3c3nc4ccccc4nc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H30N2O2/c1-29(2,3)20-15-17(16-21(28(20)34)30(4,5)6)24-26-25(18-11-7-8-12-19(18)27(24)33)31-22-13-9-10-14-23(22)32-26/h7-16,33-34H,1-6H3 |
| InChIKey | PUSZUSWSVGWDRP-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|