C28H30O2 — CID 12618650
2,6-ditert-butyl-4-(2-phenyl-1-benzofuran-3-yl)phenol (PubChem CID 12618650) has the molecular formula C28H30O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2-phenyl-1-benzofuran-3-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2-phenyl-1-benzofuran-3-yl)phenol |
|---|---|
| PubChem CID | 12618650 |
| Molecular Formula | C28H30O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(2-phenyl-1-benzofuran-3-yl)phenol |
| SMILES | CC(C)(C)c1cc(-c2c(-c3ccccc3)oc3ccccc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H30O2/c1-27(2,3)21-16-19(17-22(25(21)29)28(4,5)6)24-20-14-10-11-15-23(20)30-26(24)18-12-8-7-9-13-18/h7-17,29H,1-6H3 |
| InChIKey | YRZGQFZJEZRVDI-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |