C21H27NO3 — CID 14751310
[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-phenylmethanone (PubChem CID 14751310) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-phenylmethanone.
| Compound Name | [3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 14751310 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-phenylmethanone |
| SMILES | CN(CCO)Cc1cc(C(=O)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27NO3/c1-21(2,3)18-13-16(19(24)15-8-6-5-7-9-15)12-17(20(18)25)14-22(4)10-11-23/h5-9,12-13,23,25H,10-11,14H2,1-4H3 |
| InChIKey | UWWBEKNKMHCYGR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|