C23H28O4 — CID 14096576
methyl 4-(3,5-ditert-butyl-4-hydroxybenzoyl)benzoate (PubChem CID 14096576) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is methyl 4-(3,5-ditert-butyl-4-hydroxybenzoyl)benzoate.
| Compound Name | methyl 4-(3,5-ditert-butyl-4-hydroxybenzoyl)benzoate |
|---|---|
| PubChem CID | 14096576 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | methyl 4-(3,5-ditert-butyl-4-hydroxybenzoyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C23H28O4/c1-22(2,3)17-12-16(13-18(20(17)25)23(4,5)6)19(24)14-8-10-15(11-9-14)21(26)27-7/h8-13,25H,1-7H3 |
| InChIKey | OSEARIXWNXMXKJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |