C38H68N3O2Si2Y+2 — CID 172523914
CID 172523914 (PubChem CID 172523914) has the molecular formula C38H68N3O2Si2Y+2 and a molecular weight of 744.06 g/mol.
| Compound Name | CID 172523914 |
|---|---|
| PubChem CID | 172523914 |
| Molecular Formula | C38H68N3O2Si2Y+2 |
| Molecular Weight | 744.06 g/mol |
| Exact Mass | 743.39 |
| IUPAC Name | — |
| SMILES | CN(CCN(C)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O.C[Si](C)[N-][Si](C)C.[Y+3] |
| InChI | InChI=1S/C34H56N2O2.C4H12NSi2.Y/c1-31(2,3)25-17-23(29(37)27(19-25)33(7,8)9)21-35(13)15-16-36(14)22-24-18-26(32(4,5)6)20-28(30(24)38)34(10,11)12;1-6(2)5-7(3)4;/h17-20,37-38H,15-16,21-22H2,1-14H3;1-4H3;/q;-1;+3 |
| InChIKey | FTTOBQKXLQFQDK-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.06 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|