C34H54N2O2Zn — CID 24938861
zinc 2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methyl-methylamino]ethyl-methylamino]methyl]phenolate (PubChem CID 24938861) has the molecular formula C34H54N2O2Zn and a molecular weight of 588.21 g/mol. Its IUPAC name is zinc 2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methyl-methylamino]ethyl-methylamino]methyl]phenolate.
| Compound Name | zinc 2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methyl-methylamino]ethyl-methylamino]methyl]phenolate |
|---|---|
| PubChem CID | 24938861 |
| Molecular Formula | C34H54N2O2Zn |
| Molecular Weight | 588.21 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | zinc 2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-oxidophenyl)methyl-methylamino]ethyl-methylamino]methyl]phenolate |
| SMILES | CN(CCN(C)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1[O-])Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1[O-].[Zn+2] |
| InChI | InChI=1S/C34H56N2O2.Zn/c1-31(2,3)25-17-23(29(37)27(19-25)33(7,8)9)21-35(13)15-16-36(14)22-24-18-26(32(4,5)6)20-28(30(24)38)34(10,11)12;/h17-20,37-38H,15-16,21-22H2,1-14H3;/q;+2/p-2 |
| InChIKey | BIBGZSHOHFJXQF-UHFFFAOYSA-L |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.21 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|