C21H36LiNO3 — CID 139160043
lithium 2-[[bis(2-methoxyethyl)amino]methyl]-4,6-ditert-butylphenolate (PubChem CID 139160043) has the molecular formula C21H36LiNO3 and a molecular weight of 357.46 g/mol. Its IUPAC name is lithium 2-[[bis(2-methoxyethyl)amino]methyl]-4,6-ditert-butylphenolate.
| Compound Name | lithium 2-[[bis(2-methoxyethyl)amino]methyl]-4,6-ditert-butylphenolate |
|---|---|
| PubChem CID | 139160043 |
| Molecular Formula | C21H36LiNO3 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | lithium 2-[[bis(2-methoxyethyl)amino]methyl]-4,6-ditert-butylphenolate |
| SMILES | COCCN(CCOC)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1[O-].[Li+] |
| InChI | InChI=1S/C21H37NO3.Li/c1-20(2,3)17-13-16(19(23)18(14-17)21(4,5)6)15-22(9-11-24-7)10-12-25-8;/h13-14,23H,9-12,15H2,1-8H3;/q;+1/p-1 |
| InChIKey | MRNLWFSDPBONEL-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |