C52H71NO5Ti — CID 139126212
2-[[bis[(3,5-ditert-butyl-2-oxidophenyl)methyl]amino]methyl]-4,6-ditert-butylphenolate;cyclohepta-2,4,6-triene-1,2-diolate;titanium(4+) (PubChem CID 139126212) has the molecular formula C52H71NO5Ti and a molecular weight of 838.01 g/mol. Its IUPAC name is 2-[[bis[(3,5-ditert-butyl-2-oxidophenyl)methyl]amino]methyl]-4,6-ditert-butylphenolate;cyclohepta-2,4,6-triene-1,2-diolate;titanium(4+).
| Compound Name | 2-[[bis[(3,5-ditert-butyl-2-oxidophenyl)methyl]amino]methyl]-4,6-ditert-butylphenolate;cyclohepta-2,4,6-triene-1,2-diolate;titanium(4+) |
|---|---|
| PubChem CID | 139126212 |
| Molecular Formula | C52H71NO5Ti |
| Molecular Weight | 838.01 g/mol |
| Exact Mass | 837.48 |
| IUPAC Name | 2-[[bis[(3,5-ditert-butyl-2-oxidophenyl)methyl]amino]methyl]-4,6-ditert-butylphenolate;cyclohepta-2,4,6-triene-1,2-diolate;titanium(4+) |
| SMILES | CC(C)(C)c1cc(CN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.[O-]c1ccccc[c+]1[O-].[Ti+4] |
| InChI | InChI=1S/C45H69NO3.C7H6O2.Ti/c1-40(2,3)31-19-28(37(47)34(22-31)43(10,11)12)25-46(26-29-20-32(41(4,5)6)23-35(38(29)48)44(13,14)15)27-30-21-33(42(7,8)9)24-36(39(30)49)45(16,17)18;8-6-4-2-1-3-5-7(6)9;/h19-24,47-49H,25-27H2,1-18H3;1-5,8H;/q;;+4/p-4 |
| InChIKey | YYZUNGOQATZKST-UHFFFAOYSA-J |
| XLogP | 10.01 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.01 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|