C25H34Cl2N2O2 — CID 137124059
2,4-ditert-butyl-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethyl-methylamino]methyl]phenol (PubChem CID 137124059) has the molecular formula C25H34Cl2N2O2 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethyl-methylamino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethyl-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 137124059 |
| Molecular Formula | C25H34Cl2N2O2 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethyl-methylamino]methyl]phenol |
| SMILES | CN(CC/N=C/c1cc(Cl)cc(Cl)c1O)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H34Cl2N2O2/c1-24(2,3)18-10-17(22(30)20(12-18)25(4,5)6)15-29(7)9-8-28-14-16-11-19(26)13-21(27)23(16)31/h10-14,30-31H,8-9,15H2,1-7H3/b28-14+ |
| InChIKey | OHRYGUCYVKCGEG-CCVNUDIWSA-N |
| XLogP | 6.55 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|