C19H26NO7PS — CID 88609501
[[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenoxy]-thiophen-2-yloxyphosphoryl] formate (PubChem CID 88609501) has the molecular formula C19H26NO7PS and a molecular weight of 443.46 g/mol. Its IUPAC name is [[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenoxy]-thiophen-2-yloxyphosphoryl] formate.
| Compound Name | [[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenoxy]-thiophen-2-yloxyphosphoryl] formate |
|---|---|
| PubChem CID | 88609501 |
| Molecular Formula | C19H26NO7PS |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenoxy]-thiophen-2-yloxyphosphoryl] formate |
| SMILES | CN(CCO)Cc1cc(OP(=O)(OC=O)Oc2cccs2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H26NO7PS/c1-19(2,3)16-11-15(10-14(18(16)23)12-20(4)7-8-21)26-28(24,25-13-22)27-17-6-5-9-29-17/h5-6,9-11,13,21,23H,7-8,12H2,1-4H3 |
| InChIKey | NHMJLZXKUUPBMM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|