C24H37N2O4P — CID 139805032
2,6-ditert-butyl-4-[ethoxy-[1-(pyridin-4-ylamino)propyl]phosphoryl]oxyphenol (PubChem CID 139805032) has the molecular formula C24H37N2O4P and a molecular weight of 448.54 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[ethoxy-[1-(pyridin-4-ylamino)propyl]phosphoryl]oxyphenol.
| Compound Name | 2,6-ditert-butyl-4-[ethoxy-[1-(pyridin-4-ylamino)propyl]phosphoryl]oxyphenol |
|---|---|
| PubChem CID | 139805032 |
| Molecular Formula | C24H37N2O4P |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2,6-ditert-butyl-4-[ethoxy-[1-(pyridin-4-ylamino)propyl]phosphoryl]oxyphenol |
| SMILES | CCOP(=O)(Oc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(CC)Nc1ccncc1 |
| InChI | InChI=1S/C24H37N2O4P/c1-9-21(26-17-11-13-25-14-12-17)31(28,29-10-2)30-18-15-19(23(3,4)5)22(27)20(16-18)24(6,7)8/h11-16,21,27H,9-10H2,1-8H3,(H,25,26) |
| InChIKey | VPCVZDMIRWGUCF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|