C36H32F6N5P — CID 24896662
bis[[4-(2,3-dihydro-1H-perimidin-2-yl)phenyl]methyl]azanium hexafluorophosphate (PubChem CID 24896662) has the molecular formula C36H32F6N5P and a molecular weight of 679.65 g/mol. Its IUPAC name is bis[[4-(2,3-dihydro-1H-perimidin-2-yl)phenyl]methyl]azanium hexafluorophosphate.
| Compound Name | bis[[4-(2,3-dihydro-1H-perimidin-2-yl)phenyl]methyl]azanium hexafluorophosphate |
|---|---|
| PubChem CID | 24896662 |
| Molecular Formula | C36H32F6N5P |
| Molecular Weight | 679.65 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | bis[[4-(2,3-dihydro-1H-perimidin-2-yl)phenyl]methyl]azanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.c1cc2c3c(cccc3c1)NC(c1ccc(C[NH2+]Cc3ccc(C4Nc5cccc6cccc(c56)N4)cc3)cc1)N2 |
| InChI | InChI=1S/C36H31N5.F6P/c1-5-25-6-2-10-30-33(25)29(9-1)38-35(39-30)27-17-13-23(14-18-27)21-37-22-24-15-19-28(20-16-24)36-40-31-11-3-7-26-8-4-12-32(41-36)34(26)31;1-7(2,3,4,5)6/h1-20,35-41H,21-22H2;/q;-1/p+1 |
| InChIKey | PWPZLFNFQFURJN-UHFFFAOYSA-O |
| XLogP | 10.71 |
| TPSA | 64.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.65 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|