C21H23N3O — CID 660794
5-(diethylamino)-2-(2,3-dihydro-1H-perimidin-2-yl)phenol (PubChem CID 660794) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 5-(diethylamino)-2-(2,3-dihydro-1H-perimidin-2-yl)phenol.
| Compound Name | 5-(diethylamino)-2-(2,3-dihydro-1H-perimidin-2-yl)phenol |
|---|---|
| PubChem CID | 660794 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 5-(diethylamino)-2-(2,3-dihydro-1H-perimidin-2-yl)phenol |
| SMILES | CCN(CC)c1ccc(C2Nc3cccc4cccc(c34)N2)c(O)c1 |
| InChI | InChI=1S/C21H23N3O/c1-3-24(4-2)15-11-12-16(19(25)13-15)21-22-17-9-5-7-14-8-6-10-18(23-21)20(14)17/h5-13,21-23,25H,3-4H2,1-2H3 |
| InChIKey | RPXUXCFXWGEKGU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|