C25H36N2O4 — CID 163863619
2,4-bis[4-(diethylamino)-2-hydroxyphenyl]-2-methylcyclobutane-1,3-diol (PubChem CID 163863619) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2,4-bis[4-(diethylamino)-2-hydroxyphenyl]-2-methylcyclobutane-1,3-diol.
| Compound Name | 2,4-bis[4-(diethylamino)-2-hydroxyphenyl]-2-methylcyclobutane-1,3-diol |
|---|---|
| PubChem CID | 163863619 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 2,4-bis[4-(diethylamino)-2-hydroxyphenyl]-2-methylcyclobutane-1,3-diol |
| SMILES | CCN(CC)c1ccc(C2C(O)C(C)(c3ccc(N(CC)CC)cc3O)C2O)c(O)c1 |
| InChI | InChI=1S/C25H36N2O4/c1-6-26(7-2)16-10-12-18(20(28)14-16)22-23(30)25(5,24(22)31)19-13-11-17(15-21(19)29)27(8-3)9-4/h10-15,22-24,28-31H,6-9H2,1-5H3 |
| InChIKey | PESJFNZKIOXMEF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |