C22H29N3O2 — CID 9008021
(2S)-3-[(2S)-butan-2-yl]-2-[4-(diethylamino)-2-hydroxyphenyl]-1,2-dihydroquinazolin-4-one (PubChem CID 9008021) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2S)-3-[(2S)-butan-2-yl]-2-[4-(diethylamino)-2-hydroxyphenyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-[(2S)-butan-2-yl]-2-[4-(diethylamino)-2-hydroxyphenyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9008021 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (2S)-3-[(2S)-butan-2-yl]-2-[4-(diethylamino)-2-hydroxyphenyl]-1,2-dihydroquinazolin-4-one |
| SMILES | CC[C@H](C)N1C(=O)c2ccccc2N[C@@H]1c1ccc(N(CC)CC)cc1O |
| InChI | InChI=1S/C22H29N3O2/c1-5-15(4)25-21(23-19-11-9-8-10-17(19)22(25)27)18-13-12-16(14-20(18)26)24(6-2)7-3/h8-15,21,23,26H,5-7H2,1-4H3/t15-,21-/m0/s1 |
| InChIKey | FHVNEEVIWDZWJJ-BTYIYWSLSA-N |
| XLogP | 4.60 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|