C19H21BrN2O3 — CID 9008449
(2R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-[(2S)-butan-2-yl]-1,2-dihydroquinazolin-4-one (PubChem CID 9008449) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is (2R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-[(2S)-butan-2-yl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-[(2S)-butan-2-yl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9008449 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | (2R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3-[(2S)-butan-2-yl]-1,2-dihydroquinazolin-4-one |
| SMILES | CC[C@H](C)N1C(=O)c2ccccc2N[C@H]1c1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C19H21BrN2O3/c1-4-11(2)22-18(14-9-12(20)10-16(25-3)17(14)23)21-15-8-6-5-7-13(15)19(22)24/h5-11,18,21,23H,4H2,1-3H3/t11-,18+/m0/s1 |
| InChIKey | WVODGKJMBVCNMA-BBATYDOGSA-N |
| XLogP | 4.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|