C19H22N2O4 — CID 9008363
(2R)-3-[(2R)-butan-2-yl]-2-(3,4-dihydroxy-5-methoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 9008363) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2R)-3-[(2R)-butan-2-yl]-2-(3,4-dihydroxy-5-methoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-[(2R)-butan-2-yl]-2-(3,4-dihydroxy-5-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9008363 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2R)-3-[(2R)-butan-2-yl]-2-(3,4-dihydroxy-5-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CC[C@@H](C)N1C(=O)c2ccccc2N[C@H]1c1cc(O)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-11(2)21-18(12-9-15(22)17(23)16(10-12)25-3)20-14-8-6-5-7-13(14)19(21)24/h5-11,18,20,22-23H,4H2,1-3H3/t11-,18-/m1/s1 |
| InChIKey | LZTPYLSDWCGJTF-ADLMAVQZSA-N |
| XLogP | 3.47 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|