C18H20N2O5 — CID 32608981
(2R)-2-(3,4-dihydroxy-5-methoxyphenyl)-3-(2-methoxyethyl)-1,2-dihydroquinazolin-4-one (PubChem CID 32608981) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydroxy-5-methoxyphenyl)-3-(2-methoxyethyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-2-(3,4-dihydroxy-5-methoxyphenyl)-3-(2-methoxyethyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 32608981 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2R)-2-(3,4-dihydroxy-5-methoxyphenyl)-3-(2-methoxyethyl)-1,2-dihydroquinazolin-4-one |
| SMILES | COCCN1C(=O)c2ccccc2N[C@H]1c1cc(O)c(O)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-24-8-7-20-17(11-9-14(21)16(22)15(10-11)25-2)19-13-6-4-3-5-12(13)18(20)23/h3-6,9-10,17,19,21-22H,7-8H2,1-2H3/t17-/m1/s1 |
| InChIKey | FAMVXXJXNFEDOC-QGZVFWFLSA-N |
| XLogP | 2.32 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|