C20H17N3O2 — CID 54857414
2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-methoxyphenoxy]acetonitrile (PubChem CID 54857414) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 54857414 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(C2Nc3cccc4cccc(c34)N2)ccc1OCC#N |
| InChI | InChI=1S/C20H17N3O2/c1-24-18-12-14(8-9-17(18)25-11-10-21)20-22-15-6-2-4-13-5-3-7-16(23-20)19(13)15/h2-9,12,20,22-23H,11H2,1H3 |
| InChIKey | WBGKCZUEVYNNDA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|