C12H18ClNO3 — CID 171196234
2,6-dimethoxy-4-[(2S)-pyrrolidin-2-yl]phenol;hydrochloride (PubChem CID 171196234) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(2S)-pyrrolidin-2-yl]phenol;hydrochloride.
| Compound Name | 2,6-dimethoxy-4-[(2S)-pyrrolidin-2-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171196234 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2,6-dimethoxy-4-[(2S)-pyrrolidin-2-yl]phenol;hydrochloride |
| SMILES | COc1cc([C@@H]2CCCN2)cc(OC)c1O.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-15-10-6-8(9-4-3-5-13-9)7-11(16-2)12(10)14;/h6-7,9,13-14H,3-5H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | JKYOLSIPUPNWTO-FVGYRXGTSA-N |
| XLogP | 2.26 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |