C24H25BrN2O2 — CID 3120490
4-[1,3-bis(4-methylphenyl)imidazolidin-2-yl]-2-bromo-6-methoxyphenol (PubChem CID 3120490) has the molecular formula C24H25BrN2O2 and a molecular weight of 453.38 g/mol. Its IUPAC name is 4-[1,3-bis(4-methylphenyl)imidazolidin-2-yl]-2-bromo-6-methoxyphenol.
| Compound Name | 4-[1,3-bis(4-methylphenyl)imidazolidin-2-yl]-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 3120490 |
| Molecular Formula | C24H25BrN2O2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 4-[1,3-bis(4-methylphenyl)imidazolidin-2-yl]-2-bromo-6-methoxyphenol |
| SMILES | COc1cc(C2N(c3ccc(C)cc3)CCN2c2ccc(C)cc2)cc(Br)c1O |
| InChI | InChI=1S/C24H25BrN2O2/c1-16-4-8-19(9-5-16)26-12-13-27(20-10-6-17(2)7-11-20)24(26)18-14-21(25)23(28)22(15-18)29-3/h4-11,14-15,24,28H,12-13H2,1-3H3 |
| InChIKey | HHRREXKIVSXJEM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|