C10H9Br2NO3 — CID 169224101
4-(2,2-dibromocyclopropyl)-1-methoxy-2-nitrobenzene (PubChem CID 169224101) has the molecular formula C10H9Br2NO3 and a molecular weight of 350.99 g/mol. Its IUPAC name is 4-(2,2-dibromocyclopropyl)-1-methoxy-2-nitrobenzene.
| Compound Name | 4-(2,2-dibromocyclopropyl)-1-methoxy-2-nitrobenzene |
|---|---|
| PubChem CID | 169224101 |
| Molecular Formula | C10H9Br2NO3 |
| Molecular Weight | 350.99 g/mol |
| Exact Mass | 348.89 |
| IUPAC Name | 4-(2,2-dibromocyclopropyl)-1-methoxy-2-nitrobenzene |
| SMILES | COc1ccc(C2CC2(Br)Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9Br2NO3/c1-16-9-3-2-6(4-8(9)13(14)15)7-5-10(7,11)12/h2-4,7H,5H2,1H3 |
| InChIKey | CVYHROAICVNPNR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.99 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|