C19H21NO6 — CID 10150215
5,6,7-trimethoxy-1-(4-methoxy-3-nitrophenyl)-2,3-dihydro-1H-indene (PubChem CID 10150215) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 5,6,7-trimethoxy-1-(4-methoxy-3-nitrophenyl)-2,3-dihydro-1H-indene.
| Compound Name | 5,6,7-trimethoxy-1-(4-methoxy-3-nitrophenyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 10150215 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5,6,7-trimethoxy-1-(4-methoxy-3-nitrophenyl)-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(C2CCc3cc(OC)c(OC)c(OC)c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21NO6/c1-23-15-8-6-11(9-14(15)20(21)22)13-7-5-12-10-16(24-2)18(25-3)19(26-4)17(12)13/h6,8-10,13H,5,7H2,1-4H3 |
| InChIKey | FISYEIMXRJURBY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|