C14H16Br2O3 — CID 11486151
1,1-dibromo-5,6,7-trimethoxy-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene (PubChem CID 11486151) has the molecular formula C14H16Br2O3 and a molecular weight of 392.09 g/mol. Its IUPAC name is 1,1-dibromo-5,6,7-trimethoxy-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene.
| Compound Name | 1,1-dibromo-5,6,7-trimethoxy-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene |
|---|---|
| PubChem CID | 11486151 |
| Molecular Formula | C14H16Br2O3 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 1,1-dibromo-5,6,7-trimethoxy-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene |
| SMILES | COc1cc2c(c(OC)c1OC)C1C(CC2)C1(Br)Br |
| InChI | InChI=1S/C14H16Br2O3/c1-17-9-6-7-4-5-8-11(14(8,15)16)10(7)13(19-3)12(9)18-2/h6,8,11H,4-5H2,1-3H3 |
| InChIKey | SPRVMGGSHFACQF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|