C11H14N2O5 — CID 71428159
6,7-dimethoxy-8-nitro-1,2,3,4-tetrahydroisoquinolin-1-ol (PubChem CID 71428159) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 6,7-dimethoxy-8-nitro-1,2,3,4-tetrahydroisoquinolin-1-ol.
| Compound Name | 6,7-dimethoxy-8-nitro-1,2,3,4-tetrahydroisoquinolin-1-ol |
|---|---|
| PubChem CID | 71428159 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6,7-dimethoxy-8-nitro-1,2,3,4-tetrahydroisoquinolin-1-ol |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1OC)C(O)NCC2 |
| InChI | InChI=1S/C11H14N2O5/c1-17-7-5-6-3-4-12-11(14)8(6)9(13(15)16)10(7)18-2/h5,11-12,14H,3-4H2,1-2H3 |
| InChIKey | ZQIWERRDSCHEPE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|