C12H15ClN2O4 — CID 165355585
3-(5-chloro-2,3-dimethoxy-6-nitrophenyl)pyrrolidine (PubChem CID 165355585) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. Its IUPAC name is 3-(5-chloro-2,3-dimethoxy-6-nitrophenyl)pyrrolidine.
| Compound Name | 3-(5-chloro-2,3-dimethoxy-6-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 165355585 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-(5-chloro-2,3-dimethoxy-6-nitrophenyl)pyrrolidine |
| SMILES | COc1cc(Cl)c([N+](=O)[O-])c(C2CCNC2)c1OC |
| InChI | InChI=1S/C12H15ClN2O4/c1-18-9-5-8(13)11(15(16)17)10(12(9)19-2)7-3-4-14-6-7/h5,7,14H,3-4,6H2,1-2H3 |
| InChIKey | JFIBYAOILGQZHE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|