C18H18N4O10 — CID 16637957
4-methoxy-9-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinoline;2,4,6-trinitrophenol (PubChem CID 16637957) has the molecular formula C18H18N4O10 and a molecular weight of 450.36 g/mol. Its IUPAC name is 4-methoxy-9-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinoline;2,4,6-trinitrophenol.
| Compound Name | 4-methoxy-9-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinoline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 16637957 |
| Molecular Formula | C18H18N4O10 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 4-methoxy-9-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinoline;2,4,6-trinitrophenol |
| SMILES | COc1cc2c(c3c1OCO3)C(C)NCC2.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15NO3.C6H3N3O7/c1-7-10-8(3-4-13-7)5-9(14-2)11-12(10)16-6-15-11;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h5,7,13H,3-4,6H2,1-2H3;1-2,10H |
| InChIKey | PCAAACMDYGGJGP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 189.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|