C17H17N3O6 — CID 155541048
1-(2,4-dinitrophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 155541048) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(2,4-dinitrophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 155541048 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NCC2 |
| InChI | InChI=1S/C17H17N3O6/c1-25-15-7-10-5-6-18-17(13(10)9-16(15)26-2)12-4-3-11(19(21)22)8-14(12)20(23)24/h3-4,7-9,17-18H,5-6H2,1-2H3 |
| InChIKey | VUGGEMRDGKPGTM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|