C21H25N3O4 — CID 102399319
N-[(2S)-2-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]propyl]-1-(4-nitrophenyl)methanimine (PubChem CID 102399319) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(2S)-2-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]propyl]-1-(4-nitrophenyl)methanimine.
| Compound Name | N-[(2S)-2-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]propyl]-1-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 102399319 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[(2S)-2-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]propyl]-1-(4-nitrophenyl)methanimine |
| SMILES | COc1cc2c(cc1OC)[C@@H]([C@@H](C)C/N=C/c1ccc([N+](=O)[O-])cc1)NCC2 |
| InChI | InChI=1S/C21H25N3O4/c1-14(12-22-13-15-4-6-17(7-5-15)24(25)26)21-18-11-20(28-3)19(27-2)10-16(18)8-9-23-21/h4-7,10-11,13-14,21,23H,8-9,12H2,1-3H3/b22-13+/t14-,21+/m0/s1 |
| InChIKey | POVGHRUXSAFAOV-DDYIDRCXSA-N |
| XLogP | 3.55 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|