C19H21N3O4 — CID 10991879
(3R,10bS)-8,9-dimethoxy-3-(4-nitrophenyl)-1,2,3,5,6,10b-hexahydroimidazo[5,1-a]isoquinoline (PubChem CID 10991879) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (3R,10bS)-8,9-dimethoxy-3-(4-nitrophenyl)-1,2,3,5,6,10b-hexahydroimidazo[5,1-a]isoquinoline.
| Compound Name | (3R,10bS)-8,9-dimethoxy-3-(4-nitrophenyl)-1,2,3,5,6,10b-hexahydroimidazo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 10991879 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (3R,10bS)-8,9-dimethoxy-3-(4-nitrophenyl)-1,2,3,5,6,10b-hexahydroimidazo[5,1-a]isoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H]1CN[C@@H](c3ccc([N+](=O)[O-])cc3)N1CC2 |
| InChI | InChI=1S/C19H21N3O4/c1-25-17-9-13-7-8-21-16(15(13)10-18(17)26-2)11-20-19(21)12-3-5-14(6-4-12)22(23)24/h3-6,9-10,16,19-20H,7-8,11H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | LHMHBZXLMMFYCM-VQIMIIECSA-N |
| XLogP | 2.81 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|