C23H31N3O2 — CID 102399331
4-[(1S,4S,11bR)-9,10-dimethoxy-1-methyl-2,3,4,6,7,11b-hexahydro-1H-pyrimido[6,1-a]isoquinolin-4-yl]-N,N-dimethylaniline (PubChem CID 102399331) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[(1S,4S,11bR)-9,10-dimethoxy-1-methyl-2,3,4,6,7,11b-hexahydro-1H-pyrimido[6,1-a]isoquinolin-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(1S,4S,11bR)-9,10-dimethoxy-1-methyl-2,3,4,6,7,11b-hexahydro-1H-pyrimido[6,1-a]isoquinolin-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102399331 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-[(1S,4S,11bR)-9,10-dimethoxy-1-methyl-2,3,4,6,7,11b-hexahydro-1H-pyrimido[6,1-a]isoquinolin-4-yl]-N,N-dimethylaniline |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@@H](C)CN[C@H](c3ccc(N(C)C)cc3)N1CC2 |
| InChI | InChI=1S/C23H31N3O2/c1-15-14-24-23(16-6-8-18(9-7-16)25(2)3)26-11-10-17-12-20(27-4)21(28-5)13-19(17)22(15)26/h6-9,12-13,15,22-24H,10-11,14H2,1-5H3/t15-,22+,23-/m0/s1 |
| InChIKey | DXNUWWFWHMXKOZ-BJQRDSPESA-N |
| XLogP | 3.61 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|