C26H30N2O3 — CID 162403120
4-[6,7-dimethoxy-2-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]-N,N-dimethylaniline (PubChem CID 162403120) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-[6,7-dimethoxy-2-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6,7-dimethoxy-2-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 162403120 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-[6,7-dimethoxy-2-(4-methoxyphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(N2CCc3cc(OC)c(OC)cc3C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-27(2)20-8-6-18(7-9-20)26-23-17-25(31-5)24(30-4)16-19(23)14-15-28(26)21-10-12-22(29-3)13-11-21/h6-13,16-17,26H,14-15H2,1-5H3 |
| InChIKey | KGMWVDNVSBDQLS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|